C23H36N4O — CID 26227373
azepan-1-yl-[(5S)-5-(cyclohexylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 26227373) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is azepan-1-yl-[(5S)-5-(cyclohexylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[(5S)-5-(cyclohexylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 26227373 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | azepan-1-yl-[(5S)-5-(cyclohexylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCCC2)c2c1CC[C@H](NC1CCCCC1)C2 |
| InChI | InChI=1S/C23H36N4O/c1-2-14-27-21-13-12-19(24-18-10-6-5-7-11-18)17-20(21)22(25-27)23(28)26-15-8-3-4-9-16-26/h2,18-19,24H,1,3-17H2/t19-/m0/s1 |
| InChIKey | HSCMSMJRFNNIFQ-IBGZPJMESA-N |
| XLogP | 3.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|