C23H31N5O — CID 45160663
piperidin-1-yl-[1-prop-2-enyl-5-(2-pyridin-2-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 45160663) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is piperidin-1-yl-[1-prop-2-enyl-5-(2-pyridin-2-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | piperidin-1-yl-[1-prop-2-enyl-5-(2-pyridin-2-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 45160663 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | piperidin-1-yl-[1-prop-2-enyl-5-(2-pyridin-2-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCC2)c2c1CCC(NCCc1ccccn1)C2 |
| InChI | InChI=1S/C23H31N5O/c1-2-14-28-21-10-9-19(25-13-11-18-8-4-5-12-24-18)17-20(21)22(26-28)23(29)27-15-6-3-7-16-27/h2,4-5,8,12,19,25H,1,3,6-7,9-11,13-17H2 |
| InChIKey | FOVSOXHJOWWRPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|