C24H32N4O2 — CID 45161772
morpholin-4-yl-[5-(3-phenylpropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 45161772) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is morpholin-4-yl-[5-(3-phenylpropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | morpholin-4-yl-[5-(3-phenylpropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 45161772 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | morpholin-4-yl-[5-(3-phenylpropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCOCC2)c2c1CCC(NCCCc1ccccc1)C2 |
| InChI | InChI=1S/C24H32N4O2/c1-2-13-28-22-11-10-20(25-12-6-9-19-7-4-3-5-8-19)18-21(22)23(26-28)24(29)27-14-16-30-17-15-27/h2-5,7-8,20,25H,1,6,9-18H2 |
| InChIKey | XRLGVMUHRREZNO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|