C23H29ClN4O2 — CID 26214227
[(5S)-5-[2-(3-chlorophenyl)ethylamino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 26214227) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is [(5S)-5-[2-(3-chlorophenyl)ethylamino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(5S)-5-[2-(3-chlorophenyl)ethylamino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 26214227 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [(5S)-5-[2-(3-chlorophenyl)ethylamino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | C=CCn1nc(C(=O)N2CCOCC2)c2c1CC[C@H](NCCc1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C23H29ClN4O2/c1-2-10-28-21-7-6-19(25-9-8-17-4-3-5-18(24)15-17)16-20(21)22(26-28)23(29)27-11-13-30-14-12-27/h2-5,15,19,25H,1,6-14,16H2/t19-/m0/s1 |
| InChIKey | OSVIGHGVJHEOSQ-IBGZPJMESA-N |
| XLogP | 2.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|