C24H38N4O — CID 45162557
azepan-1-yl-[5-(cycloheptylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 45162557) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is azepan-1-yl-[5-(cycloheptylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[5-(cycloheptylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 45162557 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | azepan-1-yl-[5-(cycloheptylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCCC2)c2c1CCC(NC1CCCCCC1)C2 |
| InChI | InChI=1S/C24H38N4O/c1-2-15-28-22-14-13-20(25-19-11-7-3-4-8-12-19)18-21(22)23(26-28)24(29)27-16-9-5-6-10-17-27/h2,19-20,25H,1,3-18H2 |
| InChIKey | KUVBMJYZADJDBM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|