C22H36N4O2 — CID 45160662
piperidin-1-yl-[5-(3-propan-2-yloxypropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 45160662) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is piperidin-1-yl-[5-(3-propan-2-yloxypropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | piperidin-1-yl-[5-(3-propan-2-yloxypropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 45160662 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | piperidin-1-yl-[5-(3-propan-2-yloxypropylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCC2)c2c1CCC(NCCCOC(C)C)C2 |
| InChI | InChI=1S/C22H36N4O2/c1-4-12-26-20-10-9-18(23-11-8-15-28-17(2)3)16-19(20)21(24-26)22(27)25-13-6-5-7-14-25/h4,17-18,23H,1,5-16H2,2-3H3 |
| InChIKey | VWVPVBUNMKJIKL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|