C22H29N3O5 — CID 45162033
methyl 3-[4-(cyclohex-3-ene-1-carbonyl)-2-oxo-6-(pyridin-4-ylmethoxy)-1,4-diazepan-1-yl]propanoate (PubChem CID 45162033) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 3-[4-(cyclohex-3-ene-1-carbonyl)-2-oxo-6-(pyridin-4-ylmethoxy)-1,4-diazepan-1-yl]propanoate.
| Compound Name | methyl 3-[4-(cyclohex-3-ene-1-carbonyl)-2-oxo-6-(pyridin-4-ylmethoxy)-1,4-diazepan-1-yl]propanoate |
|---|---|
| PubChem CID | 45162033 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl 3-[4-(cyclohex-3-ene-1-carbonyl)-2-oxo-6-(pyridin-4-ylmethoxy)-1,4-diazepan-1-yl]propanoate |
| SMILES | COC(=O)CCN1CC(OCc2ccncc2)CN(C(=O)C2CC=CCC2)CC1=O |
| InChI | InChI=1S/C22H29N3O5/c1-29-21(27)9-12-24-13-19(30-16-17-7-10-23-11-8-17)14-25(15-20(24)26)22(28)18-5-3-2-4-6-18/h2-3,7-8,10-11,18-19H,4-6,9,12-16H2,1H3 |
| InChIKey | JCKSGZRGUJHMBY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|