C24H33N3O3 — CID 26137818
(6S)-4-[(1R)-cyclohex-3-ene-1-carbonyl]-1-cyclohexyl-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one (PubChem CID 26137818) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (6S)-4-[(1R)-cyclohex-3-ene-1-carbonyl]-1-cyclohexyl-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one.
| Compound Name | (6S)-4-[(1R)-cyclohex-3-ene-1-carbonyl]-1-cyclohexyl-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 26137818 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (6S)-4-[(1R)-cyclohex-3-ene-1-carbonyl]-1-cyclohexyl-6-(pyridin-3-ylmethoxy)-1,4-diazepan-2-one |
| SMILES | O=C([C@H]1CC=CCC1)N1CC(=O)N(C2CCCCC2)C[C@@H](OCc2cccnc2)C1 |
| InChI | InChI=1S/C24H33N3O3/c28-23-17-26(24(29)20-9-3-1-4-10-20)15-22(30-18-19-8-7-13-25-14-19)16-27(23)21-11-5-2-6-12-21/h1,3,7-8,13-14,20-22H,2,4-6,9-12,15-18H2/t20-,22-/m0/s1 |
| InChIKey | XXVKBBNVQIZOBA-UNMCSNQZSA-N |
| XLogP | 3.33 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|