C32H33N3O2 — CID 45162950
1-(cyclopropylmethyl)-3-isoquinolin-5-yl-6-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one (PubChem CID 45162950) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-isoquinolin-5-yl-6-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one.
| Compound Name | 1-(cyclopropylmethyl)-3-isoquinolin-5-yl-6-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 45162950 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-isoquinolin-5-yl-6-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
| SMILES | COc1ccc2c(c1)CC(N1CCc3c(cc(-c4cccc5cnccc45)c(=O)n3CC3CC3)C1)CC2 |
| InChI | InChI=1S/C32H33N3O2/c1-37-27-10-8-22-7-9-26(15-24(22)16-27)34-14-12-31-25(20-34)17-30(32(36)35(31)19-21-5-6-21)29-4-2-3-23-18-33-13-11-28(23)29/h2-4,8,10-11,13,16-18,21,26H,5-7,9,12,14-15,19-20H2,1H3 |
| InChIKey | ALDVSRUPFFGCRW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |