C22H31N3O4 — CID 45163960
methyl 2-[8-butan-2-yl-2,4-dioxo-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decan-3-yl]acetate (PubChem CID 45163960) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2-[8-butan-2-yl-2,4-dioxo-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | methyl 2-[8-butan-2-yl-2,4-dioxo-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 45163960 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | methyl 2-[8-butan-2-yl-2,4-dioxo-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CCC(C)N1CCC2(CC1)C(=O)N(CC(=O)OC)C(=O)N2CCc1ccccc1 |
| InChI | InChI=1S/C22H31N3O4/c1-4-17(2)23-14-11-22(12-15-23)20(27)24(16-19(26)29-3)21(28)25(22)13-10-18-8-6-5-7-9-18/h5-9,17H,4,10-16H2,1-3H3 |
| InChIKey | HTSMODGGUFFKOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|