C23H28N4O2S — CID 45166915
N-(3-hydroxy-2,2-dimethylpropyl)-5-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 45166915) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-5-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-5-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 45166915 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-5-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCC(C)(C)CO)sc2ncnc(NC3CCCc4ccccc43)c12 |
| InChI | InChI=1S/C23H28N4O2S/c1-14-18-20(27-17-10-6-8-15-7-4-5-9-16(15)17)25-13-26-22(18)30-19(14)21(29)24-11-23(2,3)12-28/h4-5,7,9,13,17,28H,6,8,10-12H2,1-3H3,(H,24,29)(H,25,26,27) |
| InChIKey | XENIRZHTCMABFR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |