C20H22N4OS — CID 45249432
N,N,5-trimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 45249432) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N,N,5-trimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N,N,5-trimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 45249432 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N,N,5-trimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)sc2ncnc(NC3CCCc4ccccc43)c12 |
| InChI | InChI=1S/C20H22N4OS/c1-12-16-18(21-11-22-19(16)26-17(12)20(25)24(2)3)23-15-10-6-8-13-7-4-5-9-14(13)15/h4-5,7,9,11,15H,6,8,10H2,1-3H3,(H,21,22,23) |
| InChIKey | CCZLETGSUGWSQW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |