C16H20N4 — CID 122282114
4-N,4-N-dimethyl-6-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-4,6-diamine (PubChem CID 122282114) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-6-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dimethyl-6-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 122282114 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-N,4-N-dimethyl-6-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-4,6-diamine |
| SMILES | CN(C)c1cc(NC2CCCc3ccccc32)ncn1 |
| InChI | InChI=1S/C16H20N4/c1-20(2)16-10-15(17-11-18-16)19-14-9-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,10-11,14H,5,7,9H2,1-2H3,(H,17,18,19) |
| InChIKey | CNIONUMXTATPNH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |