C14H17N5 — CID 80907834
2-hydrazinyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-amine (PubChem CID 80907834) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80907834 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-hydrazinyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-amine |
| SMILES | NNc1nccc(NC2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C14H17N5/c15-19-14-16-9-8-13(18-14)17-12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,8-9,12H,3,5,7,15H2,(H2,16,17,18,19) |
| InChIKey | XMBDDTGWGCOMGI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|