C16H21N5 — CID 80797635
6-N-ethyl-4-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-2,4,6-triamine (PubChem CID 80797635) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 6-N-ethyl-4-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-ethyl-4-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80797635 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-N-ethyl-4-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidine-2,4,6-triamine |
| SMILES | CCNc1cc(NC2CCCc3ccccc32)nc(N)n1 |
| InChI | InChI=1S/C16H21N5/c1-2-18-14-10-15(21-16(17)20-14)19-13-9-5-7-11-6-3-4-8-12(11)13/h3-4,6,8,10,13H,2,5,7,9H2,1H3,(H4,17,18,19,20,21) |
| InChIKey | MGLOBEQGCMLFLF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |