C29H30N6O2 — CID 45167259
[1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-(methoxymethyl)pyrazol-4-yl]-(2-pyridin-3-ylpiperidin-1-yl)methanone (PubChem CID 45167259) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-(methoxymethyl)pyrazol-4-yl]-(2-pyridin-3-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-(methoxymethyl)pyrazol-4-yl]-(2-pyridin-3-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 45167259 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-(methoxymethyl)pyrazol-4-yl]-(2-pyridin-3-ylpiperidin-1-yl)methanone |
| SMILES | COCc1c(C(=O)N2CCCCC2c2cccnc2)cnn1-c1ncc2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C29H30N6O2/c1-37-19-26-24(28(36)34-15-5-4-13-25(34)21-11-7-14-30-16-21)18-32-35(26)29-31-17-22-10-6-9-20-8-2-3-12-23(20)27(22)33-29/h2-3,7-8,11-12,14,16-18,25H,4-6,9-10,13,15,19H2,1H3 |
| InChIKey | JEDBMQHPVMVQGR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |