C22H27N5O4 — CID 45169915
N-[1-[7-[[3-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide (PubChem CID 45169915) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[1-[7-[[3-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[7-[[3-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 45169915 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[1-[7-[[3-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)c1nnc2n1CCN(Cc1cccc(OCCO)c1)CC2 |
| InChI | InChI=1S/C22H27N5O4/c1-16(23-22(29)19-6-3-12-31-19)21-25-24-20-7-8-26(9-10-27(20)21)15-17-4-2-5-18(14-17)30-13-11-28/h2-6,12,14,16,28H,7-11,13,15H2,1H3,(H,23,29) |
| InChIKey | LRIDYHXNJJWBRQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |