C18H31N3S — CID 45170488
2-tert-butyl-7,7-dimethyl-N-(3-methylsulfanylpropyl)-6,8-dihydro-5H-quinazolin-5-amine (PubChem CID 45170488) has the molecular formula C18H31N3S and a molecular weight of 321.53 g/mol. Its IUPAC name is 2-tert-butyl-7,7-dimethyl-N-(3-methylsulfanylpropyl)-6,8-dihydro-5H-quinazolin-5-amine.
| Compound Name | 2-tert-butyl-7,7-dimethyl-N-(3-methylsulfanylpropyl)-6,8-dihydro-5H-quinazolin-5-amine |
|---|---|
| PubChem CID | 45170488 |
| Molecular Formula | C18H31N3S |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-tert-butyl-7,7-dimethyl-N-(3-methylsulfanylpropyl)-6,8-dihydro-5H-quinazolin-5-amine |
| SMILES | CSCCCNC1CC(C)(C)Cc2nc(C(C)(C)C)ncc21 |
| InChI | InChI=1S/C18H31N3S/c1-17(2,3)16-20-12-13-14(19-8-7-9-22-6)10-18(4,5)11-15(13)21-16/h12,14,19H,7-11H2,1-6H3 |
| InChIKey | ZTZZSFPYTOGGTM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|