C24H31FN2O2 — CID 45171309
2-[1-[(2-ethoxyphenyl)methyl]-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol (PubChem CID 45171309) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is 2-[1-[(2-ethoxyphenyl)methyl]-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-[(2-ethoxyphenyl)methyl]-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45171309 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[1-[(2-ethoxyphenyl)methyl]-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol |
| SMILES | CCOc1ccccc1CN1CCN(C/C=C/c2ccc(F)cc2)CC1CCO |
| InChI | InChI=1S/C24H31FN2O2/c1-2-29-24-8-4-3-7-21(24)18-27-16-15-26(19-23(27)13-17-28)14-5-6-20-9-11-22(25)12-10-20/h3-12,23,28H,2,13-19H2,1H3/b6-5+ |
| InChIKey | BDOSGKZJBGALKS-AATRIKPKSA-N |
| XLogP | 3.81 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |