C22H33FN2O — CID 51634282
2-[(2R)-1-(cyclohexylmethyl)-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol (PubChem CID 51634282) has the molecular formula C22H33FN2O and a molecular weight of 360.52 g/mol. Its IUPAC name is 2-[(2R)-1-(cyclohexylmethyl)-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-(cyclohexylmethyl)-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51634282 |
| Molecular Formula | C22H33FN2O |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[(2R)-1-(cyclohexylmethyl)-4-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperazin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CN(C/C=C/c2ccc(F)cc2)CCN1CC1CCCCC1 |
| InChI | InChI=1S/C22H33FN2O/c23-21-10-8-19(9-11-21)7-4-13-24-14-15-25(22(18-24)12-16-26)17-20-5-2-1-3-6-20/h4,7-11,20,22,26H,1-3,5-6,12-18H2/b7-4+/t22-/m1/s1 |
| InChIKey | PINSUWQOKRITLS-ZMTJCJBESA-N |
| XLogP | 3.79 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |