C18H25FN2 — CID 77081809
1-[1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]piperidine (PubChem CID 77081809) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-[1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]piperidine.
| Compound Name | 1-[1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]piperidine |
|---|---|
| PubChem CID | 77081809 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-[1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]piperidine |
| SMILES | Fc1ccc(/C=C/CN2CCC(N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C18H25FN2/c19-17-8-6-16(7-9-17)5-4-11-20-14-10-18(15-20)21-12-2-1-3-13-21/h4-9,18H,1-3,10-15H2/b5-4+ |
| InChIKey | PWCKBPVUZORZDS-SNAWJCMRSA-N |
| XLogP | 3.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |