C19H23FN4 — CID 46994815
4-(4-cyclopropyltriazol-1-yl)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidine (PubChem CID 46994815) has the molecular formula C19H23FN4 and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(4-cyclopropyltriazol-1-yl)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidine.
| Compound Name | 4-(4-cyclopropyltriazol-1-yl)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidine |
|---|---|
| PubChem CID | 46994815 |
| Molecular Formula | C19H23FN4 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-(4-cyclopropyltriazol-1-yl)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]piperidine |
| SMILES | Fc1ccc(/C=C/CN2CCC(n3cc(C4CC4)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H23FN4/c20-17-7-3-15(4-8-17)2-1-11-23-12-9-18(10-13-23)24-14-19(21-22-24)16-5-6-16/h1-4,7-8,14,16,18H,5-6,9-13H2/b2-1+ |
| InChIKey | ZBLPJZUZTDETPY-OWOJBTEDSA-N |
| XLogP | 3.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |