C21H23FN4O — CID 45171328
[6-fluoro-2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]-(2-methylpyrrolidin-1-yl)methanone (PubChem CID 45171328) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is [6-fluoro-2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]-(2-methylpyrrolidin-1-yl)methanone.
| Compound Name | [6-fluoro-2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]-(2-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 45171328 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [6-fluoro-2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]-(2-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCCN1C(=O)c1cc(-c2cnn(C(C)C)c2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C21H23FN4O/c1-13(2)26-12-15(11-23-26)20-10-18(21(27)25-8-4-5-14(25)3)17-9-16(22)6-7-19(17)24-20/h6-7,9-14H,4-5,8H2,1-3H3 |
| InChIKey | TVZZEZOHKJMEIA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |