C21H24N4O — CID 46988948
(2-methylpyrrolidin-1-yl)-[2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]methanone (PubChem CID 46988948) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is (2-methylpyrrolidin-1-yl)-[2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]methanone.
| Compound Name | (2-methylpyrrolidin-1-yl)-[2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 46988948 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2-methylpyrrolidin-1-yl)-[2-(1-propan-2-ylpyrazol-4-yl)quinolin-4-yl]methanone |
| SMILES | CC1CCCN1C(=O)c1cc(-c2cnn(C(C)C)c2)nc2ccccc12 |
| InChI | InChI=1S/C21H24N4O/c1-14(2)25-13-16(12-22-25)20-11-18(17-8-4-5-9-19(17)23-20)21(26)24-10-6-7-15(24)3/h4-5,8-9,11-15H,6-7,10H2,1-3H3 |
| InChIKey | VTRSBXDRLXSNQB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |