C27H30N4O2S — CID 45171650
1-(4-methyl-7-methylsulfonylquinazolin-2-yl)-N-(naphthalen-1-ylmethyl)azepan-4-amine (PubChem CID 45171650) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is 1-(4-methyl-7-methylsulfonylquinazolin-2-yl)-N-(naphthalen-1-ylmethyl)azepan-4-amine.
| Compound Name | 1-(4-methyl-7-methylsulfonylquinazolin-2-yl)-N-(naphthalen-1-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 45171650 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-(4-methyl-7-methylsulfonylquinazolin-2-yl)-N-(naphthalen-1-ylmethyl)azepan-4-amine |
| SMILES | Cc1nc(N2CCCC(NCc3cccc4ccccc34)CC2)nc2cc(S(C)(=O)=O)ccc12 |
| InChI | InChI=1S/C27H30N4O2S/c1-19-24-13-12-23(34(2,32)33)17-26(24)30-27(29-19)31-15-6-10-22(14-16-31)28-18-21-9-5-8-20-7-3-4-11-25(20)21/h3-5,7-9,11-13,17,22,28H,6,10,14-16,18H2,1-2H3 |
| InChIKey | XYIKGWKKNZPJOW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |