C24H32ClN3O3 — CID 45173232
4-[1-[2-(4-chlorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]-1-cyclohexylpiperazin-2-one (PubChem CID 45173232) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is 4-[1-[2-(4-chlorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]-1-cyclohexylpiperazin-2-one.
| Compound Name | 4-[1-[2-(4-chlorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]-1-cyclohexylpiperazin-2-one |
|---|---|
| PubChem CID | 45173232 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[1-[2-(4-chlorophenyl)ethyl]-6-oxopiperidine-3-carbonyl]-1-cyclohexylpiperazin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCN(C3CCCCC3)C(=O)C2)CN1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN3O3/c25-20-9-6-18(7-10-20)12-13-26-16-19(8-11-22(26)29)24(31)27-14-15-28(23(30)17-27)21-4-2-1-3-5-21/h6-7,9-10,19,21H,1-5,8,11-17H2 |
| InChIKey | ZIGVXODZVMKBJI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |