C30H42N2O2 — CID 45173615
N-ethyl-N-[1-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-2-phenylethyl]oxane-4-carboxamide (PubChem CID 45173615) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is N-ethyl-N-[1-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-2-phenylethyl]oxane-4-carboxamide.
| Compound Name | N-ethyl-N-[1-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-2-phenylethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 45173615 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | N-ethyl-N-[1-[1-[(4-ethylphenyl)methyl]piperidin-4-yl]-2-phenylethyl]oxane-4-carboxamide |
| SMILES | CCc1ccc(CN2CCC(C(Cc3ccccc3)N(CC)C(=O)C3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C30H42N2O2/c1-3-24-10-12-26(13-11-24)23-31-18-14-27(15-19-31)29(22-25-8-6-5-7-9-25)32(4-2)30(33)28-16-20-34-21-17-28/h5-13,27-29H,3-4,14-23H2,1-2H3 |
| InChIKey | CGBCFXBRPDMROB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |