C25H32N4O3 — CID 45173916
6-[2-(cyclohexen-1-yl)acetyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 45173916) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 6-[2-(cyclohexen-1-yl)acetyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | 6-[2-(cyclohexen-1-yl)acetyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 45173916 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 6-[2-(cyclohexen-1-yl)acetyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCNC2=O)c1)C1CC12CCN(C(=O)CC1=CCCCC1)CC2 |
| InChI | InChI=1S/C25H32N4O3/c30-22(15-18-5-2-1-3-6-18)28-12-9-25(10-13-28)17-21(25)23(31)27-19-7-4-8-20(16-19)29-14-11-26-24(29)32/h4-5,7-8,16,21H,1-3,6,9-15,17H2,(H,26,32)(H,27,31) |
| InChIKey | KBTJCRBZKFJIGL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|