C21H22ClN3O — CID 45175377
3-(4-chlorophenyl)-N-methyl-3-phenyl-N-[2-(1H-pyrazol-4-yl)ethyl]propanamide (PubChem CID 45175377) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-methyl-3-phenyl-N-[2-(1H-pyrazol-4-yl)ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-methyl-3-phenyl-N-[2-(1H-pyrazol-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 45175377 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-methyl-3-phenyl-N-[2-(1H-pyrazol-4-yl)ethyl]propanamide |
| SMILES | CN(CCc1cn[nH]c1)C(=O)CC(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O/c1-25(12-11-16-14-23-24-15-16)21(26)13-20(17-5-3-2-4-6-17)18-7-9-19(22)10-8-18/h2-10,14-15,20H,11-13H2,1H3,(H,23,24) |
| InChIKey | JZGYXQYTFLQINF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |