C20H25ClN2O3 — CID 45175991
methyl 2-[7-chloro-3-[(2-ethylpiperidin-1-yl)methyl]-2-oxoquinolin-1-yl]acetate (PubChem CID 45175991) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is methyl 2-[7-chloro-3-[(2-ethylpiperidin-1-yl)methyl]-2-oxoquinolin-1-yl]acetate.
| Compound Name | methyl 2-[7-chloro-3-[(2-ethylpiperidin-1-yl)methyl]-2-oxoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 45175991 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | methyl 2-[7-chloro-3-[(2-ethylpiperidin-1-yl)methyl]-2-oxoquinolin-1-yl]acetate |
| SMILES | CCC1CCCCN1Cc1cc2ccc(Cl)cc2n(CC(=O)OC)c1=O |
| InChI | InChI=1S/C20H25ClN2O3/c1-3-17-6-4-5-9-22(17)12-15-10-14-7-8-16(21)11-18(14)23(20(15)25)13-19(24)26-2/h7-8,10-11,17H,3-6,9,12-13H2,1-2H3 |
| InChIKey | GEKYOMKVSRIBNT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |