C24H28FNO2 — CID 45177304
4-[4-[[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]but-3-yn-1-ol (PubChem CID 45177304) has the molecular formula C24H28FNO2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 4-[4-[[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-[[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 45177304 |
| Molecular Formula | C24H28FNO2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[4-[[3-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]methyl]phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccc(CN2CCCC(CO)(Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C24H28FNO2/c25-23-11-9-21(10-12-23)16-24(19-28)13-3-14-26(18-24)17-22-7-5-20(6-8-22)4-1-2-15-27/h5-12,27-28H,2-3,13-19H2 |
| InChIKey | WTJCSMZUGDPTTJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|