C23H27FN2O — CID 45183780
[3-[(4-fluorophenyl)methyl]-1-[(1-methylindol-3-yl)methyl]piperidin-3-yl]methanol (PubChem CID 45183780) has the molecular formula C23H27FN2O and a molecular weight of 366.48 g/mol. Its IUPAC name is [3-[(4-fluorophenyl)methyl]-1-[(1-methylindol-3-yl)methyl]piperidin-3-yl]methanol.
| Compound Name | [3-[(4-fluorophenyl)methyl]-1-[(1-methylindol-3-yl)methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 45183780 |
| Molecular Formula | C23H27FN2O |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [3-[(4-fluorophenyl)methyl]-1-[(1-methylindol-3-yl)methyl]piperidin-3-yl]methanol |
| SMILES | Cn1cc(CN2CCCC(CO)(Cc3ccc(F)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C23H27FN2O/c1-25-14-19(21-5-2-3-6-22(21)25)15-26-12-4-11-23(16-26,17-27)13-18-7-9-20(24)10-8-18/h2-3,5-10,14,27H,4,11-13,15-17H2,1H3 |
| InChIKey | GGFLDVUSYRHABS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |