C23H26FN3O — CID 45177870
3-(2-fluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 45177870) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 45177870 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(1-methylimidazol-2-yl)methyl]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)N(Cc1nccn1C)C(=O)CC(c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C23H26FN3O/c1-17(2)27(16-22-25-13-14-26(22)3)23(28)15-20(18-9-5-4-6-10-18)19-11-7-8-12-21(19)24/h4-14,17,20H,15-16H2,1-3H3 |
| InChIKey | HRTLHROUUAKRER-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |