C25H25FN2O2 — CID 45179274
N-[(2-fluorophenyl)methyl]-3-[2-(naphthalen-2-ylmethyl)-5-oxopyrrolidin-2-yl]propanamide (PubChem CID 45179274) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-[2-(naphthalen-2-ylmethyl)-5-oxopyrrolidin-2-yl]propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-[2-(naphthalen-2-ylmethyl)-5-oxopyrrolidin-2-yl]propanamide |
|---|---|
| PubChem CID | 45179274 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-[2-(naphthalen-2-ylmethyl)-5-oxopyrrolidin-2-yl]propanamide |
| SMILES | O=C(CCC1(Cc2ccc3ccccc3c2)CCC(=O)N1)NCc1ccccc1F |
| InChI | InChI=1S/C25H25FN2O2/c26-22-8-4-3-7-21(22)17-27-23(29)11-13-25(14-12-24(30)28-25)16-18-9-10-19-5-1-2-6-20(19)15-18/h1-10,15H,11-14,16-17H2,(H,27,29)(H,28,30) |
| InChIKey | BDZBVCOMEZHGML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |