C17H21FN2O4 — CID 91795378
3-[2-[3-[(2-fluorophenyl)methylamino]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoic acid (PubChem CID 91795378) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 3-[2-[3-[(2-fluorophenyl)methylamino]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoic acid.
| Compound Name | 3-[2-[3-[(2-fluorophenyl)methylamino]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91795378 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-[2-[3-[(2-fluorophenyl)methylamino]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)NCc2ccccc2F)CCC(=O)N1 |
| InChI | InChI=1S/C17H21FN2O4/c18-13-4-2-1-3-12(13)11-19-14(21)5-8-17(10-7-16(23)24)9-6-15(22)20-17/h1-4H,5-11H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | WKLZRUKNQGSGDY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |