C11H13BrN2O3 — CID 4517986
(3,4,5,6-tetrahydro-2H-azepin-7-ylamino) 5-bromofuran-2-carboxylate (PubChem CID 4517986) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) 5-bromofuran-2-carboxylate.
| Compound Name | (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 4517986 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) 5-bromofuran-2-carboxylate |
| SMILES | O=C(ONC1=NCCCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H13BrN2O3/c12-9-6-5-8(16-9)11(15)17-14-10-4-2-1-3-7-13-10/h5-6H,1-4,7H2,(H,13,14) |
| InChIKey | BUXPCPUJEXMCLM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|