C13H15ClN4O4 — CID 2316683
(3,4,5,6-tetrahydro-2H-azepin-7-ylamino) N-(4-chloro-3-nitrophenyl)carbamate (PubChem CID 2316683) has the molecular formula C13H15ClN4O4 and a molecular weight of 326.74 g/mol. Its IUPAC name is (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) N-(4-chloro-3-nitrophenyl)carbamate.
| Compound Name | (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) N-(4-chloro-3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 2316683 |
| Molecular Formula | C13H15ClN4O4 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (3,4,5,6-tetrahydro-2H-azepin-7-ylamino) N-(4-chloro-3-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)ONC1=NCCCCC1 |
| InChI | InChI=1S/C13H15ClN4O4/c14-10-6-5-9(8-11(10)18(20)21)16-13(19)22-17-12-4-2-1-3-7-15-12/h5-6,8H,1-4,7H2,(H,15,17)(H,16,19) |
| InChIKey | HBVILHAMNIGVNO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|