C21H34N2O4S — CID 45181608
1-[2-methoxy-4-[[methyl(oxan-4-yl)amino]methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 45181608) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-[2-methoxy-4-[[methyl(oxan-4-yl)amino]methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | 1-[2-methoxy-4-[[methyl(oxan-4-yl)amino]methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 45181608 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[2-methoxy-4-[[methyl(oxan-4-yl)amino]methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CN(C)C2CCOCC2)ccc1OCC(O)CN1CCSCC1 |
| InChI | InChI=1S/C21H34N2O4S/c1-22(18-5-9-26-10-6-18)14-17-3-4-20(21(13-17)25-2)27-16-19(24)15-23-7-11-28-12-8-23/h3-4,13,18-19,24H,5-12,14-16H2,1-2H3 |
| InChIKey | UMPSDVXWJDTNAU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |