C27H41N3O4 — CID 45182329
5-(azocane-1-carbonyl)-N-cyclooctyl-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 45182329) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is 5-(azocane-1-carbonyl)-N-cyclooctyl-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(azocane-1-carbonyl)-N-cyclooctyl-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45182329 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 5-(azocane-1-carbonyl)-N-cyclooctyl-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1cn(CC2CCCO2)cc(C(=O)N2CCCCCCC2)c1=O |
| InChI | InChI=1S/C27H41N3O4/c31-25-23(26(32)28-21-12-7-3-1-4-8-13-21)19-29(18-22-14-11-17-34-22)20-24(25)27(33)30-15-9-5-2-6-10-16-30/h19-22H,1-18H2,(H,28,32) |
| InChIKey | VAPFKJMGBBTWBA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |