C24H37N3O5 — CID 45219359
3-N-cyclooctyl-5-N-(3-methoxypropyl)-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide (PubChem CID 45219359) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-N-cyclooctyl-5-N-(3-methoxypropyl)-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-cyclooctyl-5-N-(3-methoxypropyl)-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45219359 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 3-N-cyclooctyl-5-N-(3-methoxypropyl)-4-oxo-1-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide |
| SMILES | COCCCNC(=O)c1cn(CC2CCCO2)cc(C(=O)NC2CCCCCCC2)c1=O |
| InChI | InChI=1S/C24H37N3O5/c1-31-13-8-12-25-23(29)20-16-27(15-19-11-7-14-32-19)17-21(22(20)28)24(30)26-18-9-5-3-2-4-6-10-18/h16-19H,2-15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | JILBBQMLBZDBJN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|