C19H32N4O2S — CID 45183265
2-[[3-(cyclohexylmethyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 45183265) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-[[3-(cyclohexylmethyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[3-(cyclohexylmethyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 45183265 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[[3-(cyclohexylmethyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CS(=O)(=O)c1ncc(CN2CCN3CCCC3C2)n1CC1CCCCC1 |
| InChI | InChI=1S/C19H32N4O2S/c1-26(24,25)19-20-12-18(23(19)13-16-6-3-2-4-7-16)15-21-10-11-22-9-5-8-17(22)14-21/h12,16-17H,2-11,13-15H2,1H3 |
| InChIKey | VGGMUVYJSGTSJZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |