C16H27N3O2S — CID 25273953
1-(cyclohexylmethyl)-2-methylsulfonyl-5-(pyrrolidin-1-ylmethyl)imidazole (PubChem CID 25273953) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-methylsulfonyl-5-(pyrrolidin-1-ylmethyl)imidazole.
| Compound Name | 1-(cyclohexylmethyl)-2-methylsulfonyl-5-(pyrrolidin-1-ylmethyl)imidazole |
|---|---|
| PubChem CID | 25273953 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-methylsulfonyl-5-(pyrrolidin-1-ylmethyl)imidazole |
| SMILES | CS(=O)(=O)c1ncc(CN2CCCC2)n1CC1CCCCC1 |
| InChI | InChI=1S/C16H27N3O2S/c1-22(20,21)16-17-11-15(13-18-9-5-6-10-18)19(16)12-14-7-3-2-4-8-14/h11,14H,2-10,12-13H2,1H3 |
| InChIKey | DEUIAXGHCYGNGA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |