C17H33N3O2S — CID 25273955
N-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]-N-methylethanamine (PubChem CID 25273955) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is N-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]-N-methylethanamine.
| Compound Name | N-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 25273955 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]-N-methylethanamine |
| SMILES | CCCCn1c(CN(C)CC)cnc1S(=O)(=O)CCCC(C)C |
| InChI | InChI=1S/C17H33N3O2S/c1-6-8-11-20-16(14-19(5)7-2)13-18-17(20)23(21,22)12-9-10-15(3)4/h13,15H,6-12,14H2,1-5H3 |
| InChIKey | RCSVCUQYHJVXTQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |