C17H31N3O2S — CID 25274212
N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methylpropan-2-amine (PubChem CID 25274212) has the molecular formula C17H31N3O2S and a molecular weight of 341.52 g/mol. Its IUPAC name is N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methylpropan-2-amine.
| Compound Name | N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 25274212 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methylpropan-2-amine |
| SMILES | CCCCn1c(CN(C)C(C)C)cnc1S(=O)(=O)CC1CCC1 |
| InChI | InChI=1S/C17H31N3O2S/c1-5-6-10-20-16(12-19(4)14(2)3)11-18-17(20)23(21,22)13-15-8-7-9-15/h11,14-15H,5-10,12-13H2,1-4H3 |
| InChIKey | MHZJJIMTIUIMQA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |