C23H33N5O2 — CID 45183300
1-piperidin-1-yl-3-[4-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 45183300) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-piperidin-1-yl-3-[4-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-piperidin-1-yl-3-[4-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45183300 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-piperidin-1-yl-3-[4-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(CN2CCN(c3cnccn3)CC2)cc1)CN1CCCCC1 |
| InChI | InChI=1S/C23H33N5O2/c29-21(18-26-10-2-1-3-11-26)19-30-22-6-4-20(5-7-22)17-27-12-14-28(15-13-27)23-16-24-8-9-25-23/h4-9,16,21,29H,1-3,10-15,17-19H2 |
| InChIKey | SDFIAQOWDGMOPE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |