C14H22N6O — CID 45184661
[1-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol (PubChem CID 45184661) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is [1-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 45184661 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [1-[[1-[(5-methyl-1H-imidazol-2-yl)methyl]piperidin-3-yl]methyl]triazol-4-yl]methanol |
| SMILES | Cc1cnc(CN2CCCC(Cn3cc(CO)nn3)C2)[nH]1 |
| InChI | InChI=1S/C14H22N6O/c1-11-5-15-14(16-11)9-19-4-2-3-12(6-19)7-20-8-13(10-21)17-18-20/h5,8,12,21H,2-4,6-7,9-10H2,1H3,(H,15,16) |
| InChIKey | REAKOCXNSVUGLS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |