C24H28N2O3 — CID 45184745
2-[[3-(hydroxymethyl)-3-[(3-methoxyphenyl)methyl]piperidin-1-yl]methyl]-1H-quinolin-4-one (PubChem CID 45184745) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[[3-(hydroxymethyl)-3-[(3-methoxyphenyl)methyl]piperidin-1-yl]methyl]-1H-quinolin-4-one.
| Compound Name | 2-[[3-(hydroxymethyl)-3-[(3-methoxyphenyl)methyl]piperidin-1-yl]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 45184745 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[[3-(hydroxymethyl)-3-[(3-methoxyphenyl)methyl]piperidin-1-yl]methyl]-1H-quinolin-4-one |
| SMILES | COc1cccc(CC2(CO)CCCN(Cc3cc(=O)c4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-29-20-7-4-6-18(12-20)14-24(17-27)10-5-11-26(16-24)15-19-13-23(28)21-8-2-3-9-22(21)25-19/h2-4,6-9,12-13,27H,5,10-11,14-17H2,1H3,(H,25,28) |
| InChIKey | ZHTMNCMSWUCOJF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |