C22H25ClN2O4S — CID 45184895
2-[3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 45184895) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 45184895 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COCCCN1C(=O)CC(CC(=O)N(C)Cc2cccs2)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C22H25ClN2O4S/c1-24(15-16-7-5-12-30-16)19(26)13-22(17-8-3-4-9-18(17)23)14-20(27)25(21(22)28)10-6-11-29-2/h3-5,7-9,12H,6,10-11,13-15H2,1-2H3 |
| InChIKey | YVLMNUKAPYQXDU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|