C23H31ClN2O5 — CID 42368102
2-[(3S)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 42368102) has the molecular formula C23H31ClN2O5 and a molecular weight of 450.96 g/mol. Its IUPAC name is 2-[(3S)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(3S)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 42368102 |
| Molecular Formula | C23H31ClN2O5 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[(3S)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | CCN(C[C@H]1CCCO1)C(=O)C[C@@]1(c2ccccc2Cl)CC(=O)N(CCCOC)C1=O |
| InChI | InChI=1S/C23H31ClN2O5/c1-3-25(16-17-8-6-13-31-17)20(27)14-23(18-9-4-5-10-19(18)24)15-21(28)26(22(23)29)11-7-12-30-2/h4-5,9-10,17H,3,6-8,11-16H2,1-2H3/t17-,23+/m1/s1 |
| InChIKey | GAGVPNFGQSFXGC-HXOBKFHXSA-N |
| XLogP | 2.79 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|