C17H31N3O4S — CID 45185255
N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-(oxan-2-yl)ethanamine (PubChem CID 45185255) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-(oxan-2-yl)ethanamine.
| Compound Name | N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-(oxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 45185255 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-(oxan-2-yl)ethanamine |
| SMILES | COCCCn1c(CN(C)CCC2CCCCO2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C17H31N3O4S/c1-19(10-8-16-7-4-5-12-24-16)14-15-13-18-17(25(3,21)22)20(15)9-6-11-23-2/h13,16H,4-12,14H2,1-3H3 |
| InChIKey | MXLKTYKIFDQIEQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|